C32H40N2O5S — CID 123776400
2-[[3-ethyl-4-[4-(3-hydroxyphenyl)butyl]-2,7,8-trimethylcycloocta-1,3,7-triene-1-carbonyl]amino]-3-(thiophene-2-carbonylamino)propanoic acid (PubChem CID 123776400) has the molecular formula C32H40N2O5S and a molecular weight of 564.75 g/mol. Its IUPAC name is 2-[[3-ethyl-4-[4-(3-hydroxyphenyl)butyl]-2,7,8-trimethylcycloocta-1,3,7-triene-1-carbonyl]amino]-3-(thiophene-2-carbonylamino)propanoic acid.
| Compound Name | 2-[[3-ethyl-4-[4-(3-hydroxyphenyl)butyl]-2,7,8-trimethylcycloocta-1,3,7-triene-1-carbonyl]amino]-3-(thiophene-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 123776400 |
| Molecular Formula | C32H40N2O5S |
| Molecular Weight | 564.75 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | 2-[[3-ethyl-4-[4-(3-hydroxyphenyl)butyl]-2,7,8-trimethylcycloocta-1,3,7-triene-1-carbonyl]amino]-3-(thiophene-2-carbonylamino)propanoic acid |
| SMILES | CCC1=C(CCCCc2cccc(O)c2)CCC(C)=C(C)C(C(=O)NC(CNC(=O)c2cccs2)C(=O)O)=C1C |
| InChI | InChI=1S/C32H40N2O5S/c1-5-26-22(4)29(31(37)34-27(32(38)39)19-33-30(36)28-14-9-17-40-28)21(3)20(2)15-16-24(26)12-7-6-10-23-11-8-13-25(35)18-23/h8-9,11,13-14,17-18,27,35H,5-7,10,12,15-16,19H2,1-4H3,(H,33,36)(H,34,37)(H,38,39) |
| InChIKey | ONZVIIFPNUDGHO-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.75 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|