C14H14S — CID 123776861
1,4-dimethyl-1,2-dihydrobenzo[e][1]benzothiole (PubChem CID 123776861) has the molecular formula C14H14S and a molecular weight of 214.33 g/mol. Its IUPAC name is 1,4-dimethyl-1,2-dihydrobenzo[e][1]benzothiole.
| Compound Name | 1,4-dimethyl-1,2-dihydrobenzo[e][1]benzothiole |
|---|---|
| PubChem CID | 123776861 |
| Molecular Formula | C14H14S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1,4-dimethyl-1,2-dihydrobenzo[e][1]benzothiole |
| SMILES | Cc1cc2ccccc2c2c1SCC2C |
| InChI | InChI=1S/C14H14S/c1-9-7-11-5-3-4-6-12(11)13-10(2)8-15-14(9)13/h3-7,10H,8H2,1-2H3 |
| InChIKey | ITYFGOTTWHPLIQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |