C28H29Cl3N2O2S — CID 123776887
2-chloro-N-[4-chloro-3-[(3-chlorobenzoyl)amino]phenyl]-4-(3-methyl-6-methylsulfanylhexan-2-yl)benzamide (PubChem CID 123776887) has the molecular formula C28H29Cl3N2O2S and a molecular weight of 563.98 g/mol. Its IUPAC name is 2-chloro-N-[4-chloro-3-[(3-chlorobenzoyl)amino]phenyl]-4-(3-methyl-6-methylsulfanylhexan-2-yl)benzamide.
| Compound Name | 2-chloro-N-[4-chloro-3-[(3-chlorobenzoyl)amino]phenyl]-4-(3-methyl-6-methylsulfanylhexan-2-yl)benzamide |
|---|---|
| PubChem CID | 123776887 |
| Molecular Formula | C28H29Cl3N2O2S |
| Molecular Weight | 563.98 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | 2-chloro-N-[4-chloro-3-[(3-chlorobenzoyl)amino]phenyl]-4-(3-methyl-6-methylsulfanylhexan-2-yl)benzamide |
| SMILES | CSCCCC(C)C(C)c1ccc(C(=O)Nc2ccc(Cl)c(NC(=O)c3cccc(Cl)c3)c2)c(Cl)c1 |
| InChI | InChI=1S/C28H29Cl3N2O2S/c1-17(6-5-13-36-3)18(2)19-9-11-23(25(31)15-19)28(35)32-22-10-12-24(30)26(16-22)33-27(34)20-7-4-8-21(29)14-20/h4,7-12,14-18H,5-6,13H2,1-3H3,(H,32,35)(H,33,34) |
| InChIKey | KEITWLXJCAVEPX-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.98 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|