C32H46N4O7 — CID 123777094
N-[3-(cyclohexen-1-yl)-1-(2-methyloxiran-2-yl)-1-oxopropan-2-yl]-3-(4-methoxyphenyl)-2-[2-[(2-morpholin-4-yl-3-oxopropyl)amino]propanoylamino]propanamide (PubChem CID 123777094) has the molecular formula C32H46N4O7 and a molecular weight of 598.74 g/mol. Its IUPAC name is N-[3-(cyclohexen-1-yl)-1-(2-methyloxiran-2-yl)-1-oxopropan-2-yl]-3-(4-methoxyphenyl)-2-[2-[(2-morpholin-4-yl-3-oxopropyl)amino]propanoylamino]propanamide.
| Compound Name | N-[3-(cyclohexen-1-yl)-1-(2-methyloxiran-2-yl)-1-oxopropan-2-yl]-3-(4-methoxyphenyl)-2-[2-[(2-morpholin-4-yl-3-oxopropyl)amino]propanoylamino]propanamide |
|---|---|
| PubChem CID | 123777094 |
| Molecular Formula | C32H46N4O7 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.34 |
| IUPAC Name | N-[3-(cyclohexen-1-yl)-1-(2-methyloxiran-2-yl)-1-oxopropan-2-yl]-3-(4-methoxyphenyl)-2-[2-[(2-morpholin-4-yl-3-oxopropyl)amino]propanoylamino]propanamide |
| SMILES | COc1ccc(CC(NC(=O)C(C)NCC(C=O)N2CCOCC2)C(=O)NC(CC2=CCCCC2)C(=O)C2(C)CO2)cc1 |
| InChI | InChI=1S/C32H46N4O7/c1-22(33-19-25(20-37)36-13-15-42-16-14-36)30(39)35-28(18-24-9-11-26(41-3)12-10-24)31(40)34-27(29(38)32(2)21-43-32)17-23-7-5-4-6-8-23/h7,9-12,20,22,25,27-28,33H,4-6,8,13-19,21H2,1-3H3,(H,34,40)(H,35,39) |
| InChIKey | WBVWJSAGJUKDDH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 138.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|