C28H26N5O3+ — CID 123777109
methyl N-[3-methyl-6-(4-quinolin-4-yl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-1H-benzimidazol-3-ium-2-yl]carbamate (PubChem CID 123777109) has the molecular formula C28H26N5O3+ and a molecular weight of 480.55 g/mol. Its IUPAC name is methyl N-[3-methyl-6-(4-quinolin-4-yl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-1H-benzimidazol-3-ium-2-yl]carbamate.
| Compound Name | methyl N-[3-methyl-6-(4-quinolin-4-yl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-1H-benzimidazol-3-ium-2-yl]carbamate |
|---|---|
| PubChem CID | 123777109 |
| Molecular Formula | C28H26N5O3+ |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | methyl N-[3-methyl-6-(4-quinolin-4-yl-3,5-dihydro-2H-1,4-benzoxazepin-7-yl)-1H-benzimidazol-3-ium-2-yl]carbamate |
| SMILES | COC(=O)Nc1[nH]c2cc(-c3ccc4c(c3)CN(c3ccnc5ccccc35)CCO4)ccc2[n+]1C |
| InChI | InChI=1S/C28H25N5O3/c1-32-25-9-7-19(16-23(25)30-27(32)31-28(34)35-2)18-8-10-26-20(15-18)17-33(13-14-36-26)24-11-12-29-22-6-4-3-5-21(22)24/h3-12,15-16H,13-14,17H2,1-2H3,(H,30,31,34)/p+1 |
| InChIKey | QYDSGGQOQHRXRZ-UHFFFAOYSA-O |
| XLogP | 4.78 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|