C23H17B3 — CID 123777516
CID 123777516 (PubChem CID 123777516) has the molecular formula C23H17B3 and a molecular weight of 325.83 g/mol.
| Compound Name | CID 123777516 |
|---|---|
| PubChem CID | 123777516 |
| Molecular Formula | C23H17B3 |
| Molecular Weight | 325.83 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | — |
| SMILES | [B][B][B]c1ccc2ccc3cc4c(cc3c2c1)C(C)(C)c1ccccc1-4 |
| InChI | InChI=1S/C23H17B3/c1-23(2)21-6-4-3-5-17(21)20-11-15-8-7-14-9-10-16(25-26-24)12-18(14)19(15)13-22(20)23/h3-13H,1-2H3 |
| InChIKey | URQGZANIYVQLJS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.83 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|