About (7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonine
(7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonine (PubChem CID 123778633) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is (7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonine.
Molecular Properties
| Compound Name | (7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonine |
| PubChem CID | 123778633 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonine |
| SMILES | C=C1/C=C\C=CC/N=C(/C)N1 |
| InChI | InChI=1S/C9H12N2/c1-8-6-4-3-5-7-10-9(2)11-8/h3-6H,1,7H2,2H3,(H,10,11)/b5-3?,6-4- |
| InChIKey | RKTRNMPSSOYXTH-CSRHXWDSSA-N |
| XLogP | 1.63 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonine?
The IUPAC name of (7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonine (CID 123778633) is (7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonine.
What is the SMILES notation for (7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonine?
The canonical SMILES for (7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonine is C=C1/C=C\C=CC/N=C(/C)N1.
What is the InChIKey of (7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonine?
The InChIKey is RKTRNMPSSOYXTH-CSRHXWDSSA-N. The full InChI is InChI=1S/C9H12N2/c1-8-6-4-3-5-7-10-9(2)11-8/h3-6H,1,7H2,2H3,(H,10,11)/b5-3?,6-4-.
What are the key properties of (7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonine?
(7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonine has a molecular weight of 148.21 g/mol, XLogP of 1.63, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z)-2-methyl-9-methylidene-1,4-dihydro-1,3-diazonine is sourced from PubChem (CID 123778633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).