C29H21ClF3N5O2 — CID 123778695
3-[2-amino-8-(6-chloro-3-pyridinyl)-7-methoxyquinazolin-6-yl]-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 123778695) has the molecular formula C29H21ClF3N5O2 and a molecular weight of 563.97 g/mol. Its IUPAC name is 3-[2-amino-8-(6-chloro-3-pyridinyl)-7-methoxyquinazolin-6-yl]-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[2-amino-8-(6-chloro-3-pyridinyl)-7-methoxyquinazolin-6-yl]-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 123778695 |
| Molecular Formula | C29H21ClF3N5O2 |
| Molecular Weight | 563.97 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | 3-[2-amino-8-(6-chloro-3-pyridinyl)-7-methoxyquinazolin-6-yl]-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | COc1c(-c2cc(C(=O)Nc3cccc(C(F)(F)F)c3)ccc2C)cc2cnc(N)nc2c1-c1ccc(Cl)nc1 |
| InChI | InChI=1S/C29H21ClF3N5O2/c1-15-6-7-16(27(39)37-20-5-3-4-19(12-20)29(31,32)33)10-21(15)22-11-18-14-36-28(34)38-25(18)24(26(22)40-2)17-8-9-23(30)35-13-17/h3-14H,1-2H3,(H,37,39)(H2,34,36,38) |
| InChIKey | JSQPUCRHYCPRGJ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.97 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|