C20H26N2 — CID 123778819
N-[(13E)-13-ethylidene-11-methyl-5-methylidene-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-1-yl]butan-2-imine (PubChem CID 123778819) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is N-[(13E)-13-ethylidene-11-methyl-5-methylidene-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-1-yl]butan-2-imine.
| Compound Name | N-[(13E)-13-ethylidene-11-methyl-5-methylidene-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-1-yl]butan-2-imine |
|---|---|
| PubChem CID | 123778819 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | N-[(13E)-13-ethylidene-11-methyl-5-methylidene-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-1-yl]butan-2-imine |
| SMILES | C=C1C=CC2=C(CC3C=C(C)CC2(/N=C(\C)CC)/C3=C/C)N1 |
| InChI | InChI=1S/C20H26N2/c1-6-14(4)22-20-12-13(3)10-16(17(20)7-2)11-19-18(20)9-8-15(5)21-19/h7-10,16,21H,5-6,11-12H2,1-4H3/b17-7+,22-14+ |
| InChIKey | YJVPLGMYCUYAFR-WQURBGPSSA-N |
| XLogP | 4.84 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|