C18H28BNO6 — CID 123778935
(1S)-2-hydroxy-2-[(3S)-3-(hydroxymethyl)oxiran-2-yl]-1-[(2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione (PubChem CID 123778935) has the molecular formula C18H28BNO6 and a molecular weight of 365.24 g/mol. Its IUPAC name is (1S)-2-hydroxy-2-[(3S)-3-(hydroxymethyl)oxiran-2-yl]-1-[(2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione.
| Compound Name | (1S)-2-hydroxy-2-[(3S)-3-(hydroxymethyl)oxiran-2-yl]-1-[(2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione |
|---|---|
| PubChem CID | 123778935 |
| Molecular Formula | C18H28BNO6 |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (1S)-2-hydroxy-2-[(3S)-3-(hydroxymethyl)oxiran-2-yl]-1-[(2R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione |
| SMILES | C[C@@H]1C2C[C@@H](CC1[N@+]13CC(=O)C(C1)C(=O)O[B-]3(O)C1O[C@H]1CO)C2(C)C |
| InChI | InChI=1S/C18H28BNO6/c1-9-12-4-10(18(12,2)3)5-13(9)20-6-11(14(22)7-20)17(23)26-19(20,24)16-15(8-21)25-16/h9-13,15-16,21,24H,4-8H2,1-3H3/t9-,10+,11?,12?,13?,15+,16?,19?,20-/m1/s1 |
| InChIKey | BKQJEGPPJOZWOY-YFZATEPXSA-N |
| XLogP | -0.14 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|