C12H16F3N7O2 — CID 123779399
N-[1-[6-amino-5-diazenyl-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]pyrrolidin-3-yl]acetamide (PubChem CID 123779399) has the molecular formula C12H16F3N7O2 and a molecular weight of 347.30 g/mol. Its IUPAC name is N-[1-[6-amino-5-diazenyl-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]pyrrolidin-3-yl]acetamide.
| Compound Name | N-[1-[6-amino-5-diazenyl-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 123779399 |
| Molecular Formula | C12H16F3N7O2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-[1-[6-amino-5-diazenyl-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]pyrrolidin-3-yl]acetamide |
| SMILES | [H]/N=N/c1c(N)nc(OCC(F)(F)F)nc1N1CCC(NC(C)=O)C1 |
| InChI | InChI=1S/C12H16F3N7O2/c1-6(23)18-7-2-3-22(4-7)10-8(21-17)9(16)19-11(20-10)24-5-12(13,14)15/h7,17H,2-5H2,1H3,(H,18,23)(H2,16,19,20)/b21-17+ |
| InChIKey | VEWKGIZZVVEAAH-HEHNFIMWSA-N |
| XLogP | 1.38 |
| TPSA | 129.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|