C43H45FN6O4S — CID 123779726
N-tert-butyl-2-[5-(1-fluoroethoxy)-2-(3-methylsulfonylpropylamino)benzenecarboximidoyl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 123779726) has the molecular formula C43H45FN6O4S and a molecular weight of 760.94 g/mol. Its IUPAC name is N-tert-butyl-2-[5-(1-fluoroethoxy)-2-(3-methylsulfonylpropylamino)benzenecarboximidoyl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-tert-butyl-2-[5-(1-fluoroethoxy)-2-(3-methylsulfonylpropylamino)benzenecarboximidoyl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 123779726 |
| Molecular Formula | C43H45FN6O4S |
| Molecular Weight | 760.94 g/mol |
| Exact Mass | 760.32 |
| IUPAC Name | N-tert-butyl-2-[5-(1-fluoroethoxy)-2-(3-methylsulfonylpropylamino)benzenecarboximidoyl]-5-tritylpyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | [H]/N=C(/c1cnc2c(n1)c(C(=O)NC(C)(C)C)cn2C(c1ccccc1)(c1ccccc1)c1ccccc1)c1cc(OC(C)F)ccc1NCCCS(C)(=O)=O |
| InChI | InChI=1S/C43H45FN6O4S/c1-29(44)54-33-22-23-36(46-24-15-25-55(5,52)53)34(26-33)38(45)37-27-47-40-39(48-37)35(41(51)49-42(2,3)4)28-50(40)43(30-16-9-6-10-17-30,31-18-11-7-12-19-31)32-20-13-8-14-21-32/h6-14,16-23,26-29,45-46H,15,24-25H2,1-5H3,(H,49,51)/b45-38+ |
| InChIKey | KNPZLRKBTOXNQJ-XLDZHHEVSA-N |
| XLogP | 7.76 |
| TPSA | 139.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.94 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|