About 2-methyl-N'-[(1Z)-2-methylbuta-1,3-dienyl]butanimidamide
2-methyl-N'-[(1Z)-2-methylbuta-1,3-dienyl]butanimidamide (PubChem CID 123779823) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 2-methyl-N'-[(1Z)-2-methylbuta-1,3-dienyl]butanimidamide.
Molecular Properties
| Compound Name | 2-methyl-N'-[(1Z)-2-methylbuta-1,3-dienyl]butanimidamide |
| PubChem CID | 123779823 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 2-methyl-N'-[(1Z)-2-methylbuta-1,3-dienyl]butanimidamide |
| SMILES | C=C/C(C)=C\N=C(/N)C(C)CC |
| InChI | InChI=1S/C10H18N2/c1-5-8(3)7-12-10(11)9(4)6-2/h5,7,9H,1,6H2,2-4H3,(H2,11,12)/b8-7- |
| InChIKey | PMOVUDUMODZQAU-FPLPWBNLSA-N |
| XLogP | 2.48 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N'-[(1Z)-2-methylbuta-1,3-dienyl]butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N'-[(1Z)-2-methylbuta-1,3-dienyl]butanimidamide?
The IUPAC name of 2-methyl-N'-[(1Z)-2-methylbuta-1,3-dienyl]butanimidamide (CID 123779823) is 2-methyl-N'-[(1Z)-2-methylbuta-1,3-dienyl]butanimidamide.
What is the SMILES notation for 2-methyl-N'-[(1Z)-2-methylbuta-1,3-dienyl]butanimidamide?
The canonical SMILES for 2-methyl-N'-[(1Z)-2-methylbuta-1,3-dienyl]butanimidamide is C=C/C(C)=C\N=C(/N)C(C)CC.
What is the InChIKey of 2-methyl-N'-[(1Z)-2-methylbuta-1,3-dienyl]butanimidamide?
The InChIKey is PMOVUDUMODZQAU-FPLPWBNLSA-N. The full InChI is InChI=1S/C10H18N2/c1-5-8(3)7-12-10(11)9(4)6-2/h5,7,9H,1,6H2,2-4H3,(H2,11,12)/b8-7-.
What are the key properties of 2-methyl-N'-[(1Z)-2-methylbuta-1,3-dienyl]butanimidamide?
2-methyl-N'-[(1Z)-2-methylbuta-1,3-dienyl]butanimidamide has a molecular weight of 166.27 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N'-[(1Z)-2-methylbuta-1,3-dienyl]butanimidamide is sourced from PubChem (CID 123779823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).