About N-[(5-chlorothieno[2,3-b]thiophen-2-yl)methyl]-3-methyladamantan-1-amine
N-[(5-chlorothieno[2,3-b]thiophen-2-yl)methyl]-3-methyladamantan-1-amine (PubChem CID 123779899) has the molecular formula C18H22ClNS2
and a molecular weight of 351.97 g/mol. Its IUPAC name is N-[(5-chlorothieno[2,3-b]thiophen-2-yl)methyl]-3-methyladamantan-1-amine.
Molecular Properties
| Compound Name | N-[(5-chlorothieno[2,3-b]thiophen-2-yl)methyl]-3-methyladamantan-1-amine |
| PubChem CID | 123779899 |
| Molecular Formula | C18H22ClNS2 |
| Molecular Weight | 351.97 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-[(5-chlorothieno[2,3-b]thiophen-2-yl)methyl]-3-methyladamantan-1-amine |
| SMILES | CC12CC3CC(C1)CC(NCc1cc4cc(Cl)sc4s1)(C3)C2 |
| InChI | InChI=1S/C18H22ClNS2/c1-17-5-11-2-12(6-17)8-18(7-11,10-17)20-9-14-3-13-4-15(19)22-16(13)21-14/h3-4,11-12,20H,2,5-10H2,1H3 |
| InChIKey | CIPKQTRLWFKSJI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.97 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(5-chlorothieno[2,3-b]thiophen-2-yl)methyl]-3-methyladamantan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-chlorothieno[2,3-b]thiophen-2-yl)methyl]-3-methyladamantan-1-amine?
The IUPAC name of N-[(5-chlorothieno[2,3-b]thiophen-2-yl)methyl]-3-methyladamantan-1-amine (CID 123779899) is N-[(5-chlorothieno[2,3-b]thiophen-2-yl)methyl]-3-methyladamantan-1-amine.
What is the SMILES notation for N-[(5-chlorothieno[2,3-b]thiophen-2-yl)methyl]-3-methyladamantan-1-amine?
The canonical SMILES for N-[(5-chlorothieno[2,3-b]thiophen-2-yl)methyl]-3-methyladamantan-1-amine is CC12CC3CC(C1)CC(NCc1cc4cc(Cl)sc4s1)(C3)C2.
What is the InChIKey of N-[(5-chlorothieno[2,3-b]thiophen-2-yl)methyl]-3-methyladamantan-1-amine?
The InChIKey is CIPKQTRLWFKSJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22ClNS2/c1-17-5-11-2-12(6-17)8-18(7-11,10-17)20-9-14-3-13-4-15(19)22-16(13)21-14/h3-4,11-12,20H,2,5-10H2,1H3.
What are the key properties of N-[(5-chlorothieno[2,3-b]thiophen-2-yl)methyl]-3-methyladamantan-1-amine?
N-[(5-chlorothieno[2,3-b]thiophen-2-yl)methyl]-3-methyladamantan-1-amine has a molecular weight of 351.97 g/mol, XLogP of 6.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-chlorothieno[2,3-b]thiophen-2-yl)methyl]-3-methyladamantan-1-amine is sourced from PubChem (CID 123779899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).