C30H54F2N7O2+ — CID 123780113
[1,1-diamino-2-[[5-fluoro-4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]carbamoyl]-5-methylhept-4-en-3-yl]-(2-fluoroheptylidene)-methylazanium (PubChem CID 123780113) has the molecular formula C30H54F2N7O2+ and a molecular weight of 582.81 g/mol. Its IUPAC name is [1,1-diamino-2-[[5-fluoro-4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]carbamoyl]-5-methylhept-4-en-3-yl]-(2-fluoroheptylidene)-methylazanium.
| Compound Name | [1,1-diamino-2-[[5-fluoro-4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]carbamoyl]-5-methylhept-4-en-3-yl]-(2-fluoroheptylidene)-methylazanium |
|---|---|
| PubChem CID | 123780113 |
| Molecular Formula | C30H54F2N7O2+ |
| Molecular Weight | 582.81 g/mol |
| Exact Mass | 582.43 |
| IUPAC Name | [1,1-diamino-2-[[5-fluoro-4-(6-oxo-3,4,7,8,9,9a-hexahydro-1H-pyrido[1,2-a]pyrazin-2-yl)piperidin-3-yl]carbamoyl]-5-methylhept-4-en-3-yl]-(2-fluoroheptylidene)-methylazanium |
| SMILES | CCCCCC(F)/C=[N+](\C)C(C=C(C)CC)C(C(=O)NC1CNCC(F)C1N1CCN2C(=O)CCCC2C1)C(N)N |
| InChI | InChI=1S/C30H53F2N7O2/c1-5-7-8-10-21(31)18-37(4)25(15-20(3)6-2)27(29(33)34)30(41)36-24-17-35-16-23(32)28(24)38-13-14-39-22(19-38)11-9-12-26(39)40/h15,18,21-25,27-29,35H,5-14,16-17,19,33-34H2,1-4H3/p+1/b20-15?,37-18+ |
| InChIKey | BTWLXTWUUCEPDW-KEEYQSRQSA-O |
| XLogP | 1.69 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.81 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|