C13H18S2 — CID 123780475
(3aR)-3a-methyl-3-methylidenespiro[1,2,4,5-tetrahydroindene-6,2'-1,3-dithiolane] (PubChem CID 123780475) has the molecular formula C13H18S2 and a molecular weight of 238.42 g/mol. Its IUPAC name is (3aR)-3a-methyl-3-methylidenespiro[1,2,4,5-tetrahydroindene-6,2'-1,3-dithiolane].
| Compound Name | (3aR)-3a-methyl-3-methylidenespiro[1,2,4,5-tetrahydroindene-6,2'-1,3-dithiolane] |
|---|---|
| PubChem CID | 123780475 |
| Molecular Formula | C13H18S2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (3aR)-3a-methyl-3-methylidenespiro[1,2,4,5-tetrahydroindene-6,2'-1,3-dithiolane] |
| SMILES | C=C1CCC2=CC3(CC[C@]12C)SCCS3 |
| InChI | InChI=1S/C13H18S2/c1-10-3-4-11-9-13(14-7-8-15-13)6-5-12(10,11)2/h9H,1,3-8H2,2H3/t12-/m1/s1 |
| InChIKey | BUTWAYVBIUSFBE-GFCCVEGCSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|