C11H18F2N2O — CID 123780835
(4,4-difluoropiperidin-1-yl)-piperidin-1-ylmethanone (PubChem CID 123780835) has the molecular formula C11H18F2N2O and a molecular weight of 232.27 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-piperidin-1-ylmethanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 123780835 |
| Molecular Formula | C11H18F2N2O |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-piperidin-1-ylmethanone |
| SMILES | O=C(N1CCCCC1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H18F2N2O/c12-11(13)4-8-15(9-5-11)10(16)14-6-2-1-3-7-14/h1-9H2 |
| InChIKey | CQCRCOHPGDFHKX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |