C24H27F3N4O — CID 123780885
N-[[1-[3-(1-ethyl-5-pyridin-4-yloxypyrazol-3-yl)phenyl]cyclopropyl]methyl]-4,4,4-trifluorobutan-1-amine (PubChem CID 123780885) has the molecular formula C24H27F3N4O and a molecular weight of 444.50 g/mol. Its IUPAC name is N-[[1-[3-(1-ethyl-5-pyridin-4-yloxypyrazol-3-yl)phenyl]cyclopropyl]methyl]-4,4,4-trifluorobutan-1-amine.
| Compound Name | N-[[1-[3-(1-ethyl-5-pyridin-4-yloxypyrazol-3-yl)phenyl]cyclopropyl]methyl]-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 123780885 |
| Molecular Formula | C24H27F3N4O |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | N-[[1-[3-(1-ethyl-5-pyridin-4-yloxypyrazol-3-yl)phenyl]cyclopropyl]methyl]-4,4,4-trifluorobutan-1-amine |
| SMILES | CCn1nc(-c2cccc(C3(CNCCCC(F)(F)F)CC3)c2)cc1Oc1ccncc1 |
| InChI | InChI=1S/C24H27F3N4O/c1-2-31-22(32-20-7-13-28-14-8-20)16-21(30-31)18-5-3-6-19(15-18)23(10-11-23)17-29-12-4-9-24(25,26)27/h3,5-8,13-16,29H,2,4,9-12,17H2,1H3 |
| InChIKey | HNNGPOMMEVQXPU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|