About (4-amino-6-phenyl-1,3,5-triazin-2-yl)-dimethyl-phenylazanium
(4-amino-6-phenyl-1,3,5-triazin-2-yl)-dimethyl-phenylazanium (PubChem CID 123780943) has the molecular formula C17H18N5+
and a molecular weight of 292.37 g/mol. Its IUPAC name is (4-amino-6-phenyl-1,3,5-triazin-2-yl)-dimethyl-phenylazanium.
Molecular Properties
| Compound Name | (4-amino-6-phenyl-1,3,5-triazin-2-yl)-dimethyl-phenylazanium |
| PubChem CID | 123780943 |
| Molecular Formula | C17H18N5+ |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (4-amino-6-phenyl-1,3,5-triazin-2-yl)-dimethyl-phenylazanium |
| SMILES | C[N+](C)(c1ccccc1)c1nc(N)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H18N5/c1-22(2,14-11-7-4-8-12-14)17-20-15(19-16(18)21-17)13-9-5-3-6-10-13/h3-12H,1-2H3,(H2,18,19,20,21)/q+1 |
| InChIKey | MMNYMGNEHLNTCK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-6-phenyl-1,3,5-triazin-2-yl)-dimethyl-phenylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-6-phenyl-1,3,5-triazin-2-yl)-dimethyl-phenylazanium?
The IUPAC name of (4-amino-6-phenyl-1,3,5-triazin-2-yl)-dimethyl-phenylazanium (CID 123780943) is (4-amino-6-phenyl-1,3,5-triazin-2-yl)-dimethyl-phenylazanium.
What is the SMILES notation for (4-amino-6-phenyl-1,3,5-triazin-2-yl)-dimethyl-phenylazanium?
The canonical SMILES for (4-amino-6-phenyl-1,3,5-triazin-2-yl)-dimethyl-phenylazanium is C[N+](C)(c1ccccc1)c1nc(N)nc(-c2ccccc2)n1.
What is the InChIKey of (4-amino-6-phenyl-1,3,5-triazin-2-yl)-dimethyl-phenylazanium?
The InChIKey is MMNYMGNEHLNTCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N5/c1-22(2,14-11-7-4-8-12-14)17-20-15(19-16(18)21-17)13-9-5-3-6-10-13/h3-12H,1-2H3,(H2,18,19,20,21)/q+1.
What are the key properties of (4-amino-6-phenyl-1,3,5-triazin-2-yl)-dimethyl-phenylazanium?
(4-amino-6-phenyl-1,3,5-triazin-2-yl)-dimethyl-phenylazanium has a molecular weight of 292.37 g/mol, XLogP of 3.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-6-phenyl-1,3,5-triazin-2-yl)-dimethyl-phenylazanium is sourced from PubChem (CID 123780943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).