C33H33F3N4O — CID 123780996
7-ethyl-8-(4-piperidin-4-ylanilino)-3-prop-1-ynyl-1-[[2-(trifluoromethyl)phenyl]methyl]-6H-pyrido[2,3-b]azepin-2-one (PubChem CID 123780996) has the molecular formula C33H33F3N4O and a molecular weight of 558.65 g/mol. Its IUPAC name is 7-ethyl-8-(4-piperidin-4-ylanilino)-3-prop-1-ynyl-1-[[2-(trifluoromethyl)phenyl]methyl]-6H-pyrido[2,3-b]azepin-2-one.
| Compound Name | 7-ethyl-8-(4-piperidin-4-ylanilino)-3-prop-1-ynyl-1-[[2-(trifluoromethyl)phenyl]methyl]-6H-pyrido[2,3-b]azepin-2-one |
|---|---|
| PubChem CID | 123780996 |
| Molecular Formula | C33H33F3N4O |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | 7-ethyl-8-(4-piperidin-4-ylanilino)-3-prop-1-ynyl-1-[[2-(trifluoromethyl)phenyl]methyl]-6H-pyrido[2,3-b]azepin-2-one |
| SMILES | CC#Cc1cc2c(n(Cc3ccccc3C(F)(F)F)c1=O)=NC(Nc1ccc(C3CCNCC3)cc1)=C(CC)CC=2 |
| InChI | InChI=1S/C33H33F3N4O/c1-3-7-26-20-25-11-10-22(4-2)30(38-28-14-12-23(13-15-28)24-16-18-37-19-17-24)39-31(25)40(32(26)41)21-27-8-5-6-9-29(27)33(34,35)36/h5-6,8-9,11-15,20,24,37-38H,4,10,16-19,21H2,1-2H3 |
| InChIKey | WLIFBGAYTPHRDM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|