C19H14F3N5O2 — CID 123781262
6-(furan-2-yl)-9-pyridin-3-yl-2-(trifluoromethyl)-6,7,8a,9-tetrahydro-5H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 123781262) has the molecular formula C19H14F3N5O2 and a molecular weight of 401.35 g/mol. Its IUPAC name is 6-(furan-2-yl)-9-pyridin-3-yl-2-(trifluoromethyl)-6,7,8a,9-tetrahydro-5H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 6-(furan-2-yl)-9-pyridin-3-yl-2-(trifluoromethyl)-6,7,8a,9-tetrahydro-5H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 123781262 |
| Molecular Formula | C19H14F3N5O2 |
| Molecular Weight | 401.35 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 6-(furan-2-yl)-9-pyridin-3-yl-2-(trifluoromethyl)-6,7,8a,9-tetrahydro-5H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | O=C1CC(c2ccco2)CC2=Nc3nc(C(F)(F)F)nn3C(c3cccnc3)C12 |
| InChI | InChI=1S/C19H14F3N5O2/c20-19(21,22)17-25-18-24-12-7-11(14-4-2-6-29-14)8-13(28)15(12)16(27(18)26-17)10-3-1-5-23-9-10/h1-6,9,11,15-16H,7-8H2 |
| InChIKey | XTWHYPUBCIRPEH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 86.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |