C18H18F4N2O4 — CID 123781335
3-(1-amino-2-methyl-1-oxopropan-2-yl)-N-[2-methyl-4-(1,1,2,2-tetrafluoroethoxy)phenyl]furan-2-carboxamide (PubChem CID 123781335) has the molecular formula C18H18F4N2O4 and a molecular weight of 402.34 g/mol. Its IUPAC name is 3-(1-amino-2-methyl-1-oxopropan-2-yl)-N-[2-methyl-4-(1,1,2,2-tetrafluoroethoxy)phenyl]furan-2-carboxamide.
| Compound Name | 3-(1-amino-2-methyl-1-oxopropan-2-yl)-N-[2-methyl-4-(1,1,2,2-tetrafluoroethoxy)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 123781335 |
| Molecular Formula | C18H18F4N2O4 |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 3-(1-amino-2-methyl-1-oxopropan-2-yl)-N-[2-methyl-4-(1,1,2,2-tetrafluoroethoxy)phenyl]furan-2-carboxamide |
| SMILES | Cc1cc(OC(F)(F)C(F)F)ccc1NC(=O)c1occc1C(C)(C)C(N)=O |
| InChI | InChI=1S/C18H18F4N2O4/c1-9-8-10(28-18(21,22)15(19)20)4-5-12(9)24-14(25)13-11(6-7-27-13)17(2,3)16(23)26/h4-8,15H,1-3H3,(H2,23,26)(H,24,25) |
| InChIKey | YHPLEODOYDGYCJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|