C28H35F5N4O5Si — CID 123781429
methyl 2,2-dimethyl-3-[[5-[4-[5-(2,2,3,3,3-pentafluoropropoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate (PubChem CID 123781429) has the molecular formula C28H35F5N4O5Si and a molecular weight of 630.69 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-[[5-[4-[5-(2,2,3,3,3-pentafluoropropoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate.
| Compound Name | methyl 2,2-dimethyl-3-[[5-[4-[5-(2,2,3,3,3-pentafluoropropoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate |
|---|---|
| PubChem CID | 123781429 |
| Molecular Formula | C28H35F5N4O5Si |
| Molecular Weight | 630.69 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | methyl 2,2-dimethyl-3-[[5-[4-[5-(2,2,3,3,3-pentafluoropropoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]propanoate |
| SMILES | COC(=O)C(C)(C)COc1ccc(-c2ccc(-c3nc(OCC(F)(F)C(F)(F)F)n(COCC[Si](C)(C)C)n3)cc2)cn1 |
| InChI | InChI=1S/C28H35F5N4O5Si/c1-26(2,24(38)39-3)16-41-22-12-11-21(15-34-22)19-7-9-20(10-8-19)23-35-25(42-17-27(29,30)28(31,32)33)37(36-23)18-40-13-14-43(4,5)6/h7-12,15H,13-14,16-18H2,1-6H3 |
| InChIKey | HTZXQOXWKFCZJJ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.69 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|