C24H31B2N3O3 — CID 123781746
methyl-[(1R,3S,4S)-3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-benzo[e]benzimidazol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]borinic acid (PubChem CID 123781746) has the molecular formula C24H31B2N3O3 and a molecular weight of 431.15 g/mol. Its IUPAC name is methyl-[(1R,3S,4S)-3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-benzo[e]benzimidazol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]borinic acid.
| Compound Name | methyl-[(1R,3S,4S)-3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-benzo[e]benzimidazol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]borinic acid |
|---|---|
| PubChem CID | 123781746 |
| Molecular Formula | C24H31B2N3O3 |
| Molecular Weight | 431.15 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | methyl-[(1R,3S,4S)-3-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-benzo[e]benzimidazol-2-yl]-2-azabicyclo[2.2.1]heptan-2-yl]borinic acid |
| SMILES | CB(O)N1[C@@H]2CC[C@@H](C2)[C@H]1c1nc2c(ccc3cc(B4OC(C)(C)C(C)(C)O4)ccc32)[nH]1 |
| InChI | InChI=1S/C24H31B2N3O3/c1-23(2)24(3,4)32-26(31-23)16-8-10-18-14(12-16)7-11-19-20(18)28-22(27-19)21-15-6-9-17(13-15)29(21)25(5)30/h7-8,10-12,15,17,21,30H,6,9,13H2,1-5H3,(H,27,28)/t15-,17+,21-/m0/s1 |
| InChIKey | XKMSHJWCGBRBRP-XPIZARPCSA-N |
| XLogP | 3.65 |
| TPSA | 70.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.15 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|