C20H21ClN6O2 — CID 123782065
(6-chloro-3-pyridinyl)-[4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]methanone (PubChem CID 123782065) has the molecular formula C20H21ClN6O2 and a molecular weight of 412.88 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)-[4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]methanone.
| Compound Name | (6-chloro-3-pyridinyl)-[4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 123782065 |
| Molecular Formula | C20H21ClN6O2 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (6-chloro-3-pyridinyl)-[4-[(2,4-diaminoquinazolin-5-yl)oxymethyl]piperidin-1-yl]methanone |
| SMILES | Nc1nc(N)c2c(OCC3CCN(C(=O)c4ccc(Cl)nc4)CC3)cccc2n1 |
| InChI | InChI=1S/C20H21ClN6O2/c21-16-5-4-13(10-24-16)19(28)27-8-6-12(7-9-27)11-29-15-3-1-2-14-17(15)18(22)26-20(23)25-14/h1-5,10,12H,6-9,11H2,(H4,22,23,25,26) |
| InChIKey | NHBPJAABAQVJMO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|