About CID 123782636
CID 123782636 (PubChem CID 123782636) has the molecular formula C27H37NO2
and a molecular weight of 407.60 g/mol.
Molecular Properties
| Compound Name | CID 123782636 |
| PubChem CID | 123782636 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | — |
| SMILES | CCC12C3OC(=O)C(CNCc4ccccc4)C3CCC3(CC3)C1CC(C)C21CC1 |
| InChI | InChI=1S/C27H37NO2/c1-3-27-22(15-18(2)26(27)13-14-26)25(11-12-25)10-9-20-21(24(29)30-23(20)27)17-28-16-19-7-5-4-6-8-19/h4-8,18,20-23,28H,3,9-17H2,1-2H3 |
| InChIKey | GJKRPGPOYAAWHD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 123782636 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123782636?
The IUPAC name of CID 123782636 (CID 123782636) is not available.
What is the SMILES notation for CID 123782636?
The canonical SMILES for CID 123782636 is CCC12C3OC(=O)C(CNCc4ccccc4)C3CCC3(CC3)C1CC(C)C21CC1.
What is the InChIKey of CID 123782636?
The InChIKey is GJKRPGPOYAAWHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H37NO2/c1-3-27-22(15-18(2)26(27)13-14-26)25(11-12-25)10-9-20-21(24(29)30-23(20)27)17-28-16-19-7-5-4-6-8-19/h4-8,18,20-23,28H,3,9-17H2,1-2H3.
What are the key properties of CID 123782636?
CID 123782636 has a molecular weight of 407.60 g/mol, XLogP of 5.34, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123782636 is sourced from PubChem (CID 123782636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).