C19H29NO4 — CID 123782759
6-(5-amino-2,4,4-trimethyl-5-oxopentan-2-yl)oxy-1,6-dimethylcycloocta-2,4,7-triene-1-carboxylic acid (PubChem CID 123782759) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 6-(5-amino-2,4,4-trimethyl-5-oxopentan-2-yl)oxy-1,6-dimethylcycloocta-2,4,7-triene-1-carboxylic acid.
| Compound Name | 6-(5-amino-2,4,4-trimethyl-5-oxopentan-2-yl)oxy-1,6-dimethylcycloocta-2,4,7-triene-1-carboxylic acid |
|---|---|
| PubChem CID | 123782759 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 6-(5-amino-2,4,4-trimethyl-5-oxopentan-2-yl)oxy-1,6-dimethylcycloocta-2,4,7-triene-1-carboxylic acid |
| SMILES | CC1(OC(C)(C)CC(C)(C)C(N)=O)C=CC=CC(C)(C(=O)O)C=C1 |
| InChI | InChI=1S/C19H29NO4/c1-16(2,14(20)21)13-17(3,4)24-19(6)10-8-7-9-18(5,11-12-19)15(22)23/h7-12H,13H2,1-6H3,(H2,20,21)(H,22,23) |
| InChIKey | TWGCTFGXPYWQOQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|