C23H25NO6 — CID 123783083
4-[(1,2,3-trihydroxy-4,5,6,7-tetrahydro-4,7-epoxyisoindol-5-yl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione (PubChem CID 123783083) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is 4-[(1,2,3-trihydroxy-4,5,6,7-tetrahydro-4,7-epoxyisoindol-5-yl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione.
| Compound Name | 4-[(1,2,3-trihydroxy-4,5,6,7-tetrahydro-4,7-epoxyisoindol-5-yl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 123783083 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 4-[(1,2,3-trihydroxy-4,5,6,7-tetrahydro-4,7-epoxyisoindol-5-yl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CC3CC4OC3c3c4c(O)n(O)c3O)C2=O)c(C)c1 |
| InChI | InChI=1S/C23H25NO6/c1-9-4-10(2)16(11(3)5-9)17-14(25)7-12(20(17)26)6-13-8-15-18-19(21(13)30-15)23(28)24(29)22(18)27/h4-5,12-13,15,17,21,27-29H,6-8H2,1-3H3 |
| InChIKey | IFJLRAKFQCSKMC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|