C10H14O6 — CID 123783300
5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methoxyoxolane-2,4-dione (PubChem CID 123783300) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methoxyoxolane-2,4-dione.
| Compound Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methoxyoxolane-2,4-dione |
|---|---|
| PubChem CID | 123783300 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-methoxyoxolane-2,4-dione |
| SMILES | COC1C(=O)OC(C2COC(C)(C)O2)C1=O |
| InChI | InChI=1S/C10H14O6/c1-10(2)14-4-5(16-10)7-6(11)8(13-3)9(12)15-7/h5,7-8H,4H2,1-3H3 |
| InChIKey | VZWZFRGHYDOHQQ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|