C60H48N2OSSi2 — CID 123783372
2-(8,8-dimethyl-5,5-diphenylfluoreno[4,3-b][1,4]benzoxasilin-1-yl)-6-(5,5,8,8-tetramethylfluoreno[4,3-b][1,4]benzothiasilin-1-yl)pyrazine (PubChem CID 123783372) has the molecular formula C60H48N2OSSi2 and a molecular weight of 901.30 g/mol. Its IUPAC name is 2-(8,8-dimethyl-5,5-diphenylfluoreno[4,3-b][1,4]benzoxasilin-1-yl)-6-(5,5,8,8-tetramethylfluoreno[4,3-b][1,4]benzothiasilin-1-yl)pyrazine.
| Compound Name | 2-(8,8-dimethyl-5,5-diphenylfluoreno[4,3-b][1,4]benzoxasilin-1-yl)-6-(5,5,8,8-tetramethylfluoreno[4,3-b][1,4]benzothiasilin-1-yl)pyrazine |
|---|---|
| PubChem CID | 123783372 |
| Molecular Formula | C60H48N2OSSi2 |
| Molecular Weight | 901.30 g/mol |
| Exact Mass | 900.30 |
| IUPAC Name | 2-(8,8-dimethyl-5,5-diphenylfluoreno[4,3-b][1,4]benzoxasilin-1-yl)-6-(5,5,8,8-tetramethylfluoreno[4,3-b][1,4]benzothiasilin-1-yl)pyrazine |
| SMILES | CC1(C)c2ccccc2-c2c1ccc1c2Oc2c(-c3cncc(-c4cccc5c4Sc4c(ccc6c4-c4ccccc4C6(C)C)[Si]5(C)C)n3)cccc2[Si]1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C60H48N2OSSi2/c1-59(2)43-27-15-13-23-39(43)53-45(59)31-33-50-56(53)63-55-41(25-17-29-49(55)66(50,37-19-9-7-10-20-37)38-21-11-8-12-22-38)47-35-61-36-48(62-47)42-26-18-30-51-57(42)64-58-52(65(51,5)6)34-32-46-54(58)40-24-14-16-28-44(40)60(46,3)4/h7-36H,1-6H3 |
| InChIKey | LSNAGNGMOMXHES-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.30 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|