C15H20N4O4S2 — CID 123784268
[3-ethyl-5-[4-(1,2,4-thiadiazol-5-yldiazenyl)phenyl]pentyl] hydrogen sulfate (PubChem CID 123784268) has the molecular formula C15H20N4O4S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is [3-ethyl-5-[4-(1,2,4-thiadiazol-5-yldiazenyl)phenyl]pentyl] hydrogen sulfate.
| Compound Name | [3-ethyl-5-[4-(1,2,4-thiadiazol-5-yldiazenyl)phenyl]pentyl] hydrogen sulfate |
|---|---|
| PubChem CID | 123784268 |
| Molecular Formula | C15H20N4O4S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [3-ethyl-5-[4-(1,2,4-thiadiazol-5-yldiazenyl)phenyl]pentyl] hydrogen sulfate |
| SMILES | CCC(CCOS(=O)(=O)O)CCc1ccc(/N=N/c2ncns2)cc1 |
| InChI | InChI=1S/C15H20N4O4S2/c1-2-12(9-10-23-25(20,21)22)3-4-13-5-7-14(8-6-13)18-19-15-16-11-17-24-15/h5-8,11-12H,2-4,9-10H2,1H3,(H,20,21,22)/b19-18+ |
| InChIKey | MWZUXARXJPSACC-VHEBQXMUSA-N |
| XLogP | 4.12 |
| TPSA | 114.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|