C20H33N — CID 123784423
(E)-N-[(3E,5E)-5,6-diethylocta-3,5,7-trien-4-yl]-5-methylhept-4-en-3-imine (PubChem CID 123784423) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is (E)-N-[(3E,5E)-5,6-diethylocta-3,5,7-trien-4-yl]-5-methylhept-4-en-3-imine.
| Compound Name | (E)-N-[(3E,5E)-5,6-diethylocta-3,5,7-trien-4-yl]-5-methylhept-4-en-3-imine |
|---|---|
| PubChem CID | 123784423 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | (E)-N-[(3E,5E)-5,6-diethylocta-3,5,7-trien-4-yl]-5-methylhept-4-en-3-imine |
| SMILES | C=C/C(CC)=C(CC)/C(=C\CC)/N=C(/C=C(\C)CC)CC |
| InChI | InChI=1S/C20H33N/c1-8-14-20(19(13-6)17(10-3)11-4)21-18(12-5)15-16(7)9-2/h10,14-15H,3,8-9,11-13H2,1-2,4-7H3/b16-15+,19-17-,20-14+,21-18+ |
| InChIKey | HBPGVBIKUNSXJP-IGGIMIAFSA-N |
| XLogP | 6.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|