C16H20O6 — CID 123784528
ethyl 2-[acetyloxy-(5-hydroxy-3-methoxycyclohepta-1,3,6-trien-1-yl)methyl]prop-2-enoate (PubChem CID 123784528) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is ethyl 2-[acetyloxy-(5-hydroxy-3-methoxycyclohepta-1,3,6-trien-1-yl)methyl]prop-2-enoate.
| Compound Name | ethyl 2-[acetyloxy-(5-hydroxy-3-methoxycyclohepta-1,3,6-trien-1-yl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 123784528 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | ethyl 2-[acetyloxy-(5-hydroxy-3-methoxycyclohepta-1,3,6-trien-1-yl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OCC)C(OC(C)=O)C1=CC(OC)=CC(O)C=C1 |
| InChI | InChI=1S/C16H20O6/c1-5-21-16(19)10(2)15(22-11(3)17)12-6-7-13(18)9-14(8-12)20-4/h6-9,13,15,18H,2,5H2,1,3-4H3 |
| InChIKey | NLFPPRBEOQPICT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|