C22H26BN3O2 — CID 123784661
6-methyl-N-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,7-naphthyridin-8-amine (PubChem CID 123784661) has the molecular formula C22H26BN3O2 and a molecular weight of 375.28 g/mol. Its IUPAC name is 6-methyl-N-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,7-naphthyridin-8-amine.
| Compound Name | 6-methyl-N-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,7-naphthyridin-8-amine |
|---|---|
| PubChem CID | 123784661 |
| Molecular Formula | C22H26BN3O2 |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 6-methyl-N-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,7-naphthyridin-8-amine |
| SMILES | Cc1cc(Nc2nc(C)cc3cccnc23)cc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C22H26BN3O2/c1-14-10-17(23-27-21(3,4)22(5,6)28-23)13-18(11-14)26-20-19-16(8-7-9-24-19)12-15(2)25-20/h7-13H,1-6H3,(H,25,26) |
| InChIKey | LPFCWHSARDPBMF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|