C37H58N2O6 — CID 123784670
(2,5-dihydroxypyrrol-1-yl) 5-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]pentanoate (PubChem CID 123784670) has the molecular formula C37H58N2O6 and a molecular weight of 626.88 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 5-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]pentanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 5-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 123784670 |
| Molecular Formula | C37H58N2O6 |
| Molecular Weight | 626.88 g/mol |
| Exact Mass | 626.43 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 5-[[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxycarbonylamino]pentanoate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)NCCCCC(=O)On5c(O)ccc5O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C37H58N2O6/c1-24(2)9-8-10-25(3)29-14-15-30-28-13-12-26-23-27(18-20-36(26,4)31(28)19-21-37(29,30)5)44-35(43)38-22-7-6-11-34(42)45-39-32(40)16-17-33(39)41/h12,16-17,24-25,27-31,40-41H,6-11,13-15,18-23H2,1-5H3,(H,38,43) |
| InChIKey | GQYFREMMZYQKGW-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.88 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|