C19H38N2O2 — CID 123784721
2,2,4,4-tetramethyl-N-[2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl]pentanamide (PubChem CID 123784721) has the molecular formula C19H38N2O2 and a molecular weight of 326.53 g/mol. Its IUPAC name is 2,2,4,4-tetramethyl-N-[2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl]pentanamide.
| Compound Name | 2,2,4,4-tetramethyl-N-[2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl]pentanamide |
|---|---|
| PubChem CID | 123784721 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | 2,2,4,4-tetramethyl-N-[2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl]pentanamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)CNC(=O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C19H38N2O2/c1-16(2,3)12-18(7,8)15(23)20-11-14(22)21-19(9,10)13-17(4,5)6/h11-13H2,1-10H3,(H,20,23)(H,21,22) |
| InChIKey | FXZOTFADCQCNFT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |