C14H11N3OS — CID 1237855
(3R,4S)-4-methyl-2-oxo-4-phenyl-6-sulfanyl-1,3-dihydropyridine-3,5-dicarbonitrile (PubChem CID 1237855) has the molecular formula C14H11N3OS and a molecular weight of 269.33 g/mol. Its IUPAC name is (3R,4S)-4-methyl-2-oxo-4-phenyl-6-sulfanyl-1,3-dihydropyridine-3,5-dicarbonitrile.
| Compound Name | (3R,4S)-4-methyl-2-oxo-4-phenyl-6-sulfanyl-1,3-dihydropyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 1237855 |
| Molecular Formula | C14H11N3OS |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | (3R,4S)-4-methyl-2-oxo-4-phenyl-6-sulfanyl-1,3-dihydropyridine-3,5-dicarbonitrile |
| SMILES | C[C@]1(c2ccccc2)C(C#N)=C(S)NC(=O)[C@H]1C#N |
| InChI | InChI=1S/C14H11N3OS/c1-14(9-5-3-2-4-6-9)10(7-15)12(18)17-13(19)11(14)8-16/h2-6,10,19H,1H3,(H,17,18)/t10-,14-/m1/s1 |
| InChIKey | RZSQEPPLQLZMSM-QMTHXVAHSA-N |
| XLogP | 1.88 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|