About 4-O-(5-cyclohexyl-4-oxopentyl) 1-O-methyl 2-methylbutanedioate
4-O-(5-cyclohexyl-4-oxopentyl) 1-O-methyl 2-methylbutanedioate (PubChem CID 123785670) has the molecular formula C17H28O5
and a molecular weight of 312.41 g/mol. Its IUPAC name is 4-O-(5-cyclohexyl-4-oxopentyl) 1-O-methyl 2-methylbutanedioate.
Molecular Properties
| Compound Name | 4-O-(5-cyclohexyl-4-oxopentyl) 1-O-methyl 2-methylbutanedioate |
| PubChem CID | 123785670 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 4-O-(5-cyclohexyl-4-oxopentyl) 1-O-methyl 2-methylbutanedioate |
| SMILES | COC(=O)C(C)CC(=O)OCCCC(=O)CC1CCCCC1 |
| InChI | InChI=1S/C17H28O5/c1-13(17(20)21-2)11-16(19)22-10-6-9-15(18)12-14-7-4-3-5-8-14/h13-14H,3-12H2,1-2H3 |
| InChIKey | BLOMTDSWBABEIL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(5-cyclohexyl-4-oxopentyl) 1-O-methyl 2-methylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(5-cyclohexyl-4-oxopentyl) 1-O-methyl 2-methylbutanedioate?
The IUPAC name of 4-O-(5-cyclohexyl-4-oxopentyl) 1-O-methyl 2-methylbutanedioate (CID 123785670) is 4-O-(5-cyclohexyl-4-oxopentyl) 1-O-methyl 2-methylbutanedioate.
What is the SMILES notation for 4-O-(5-cyclohexyl-4-oxopentyl) 1-O-methyl 2-methylbutanedioate?
The canonical SMILES for 4-O-(5-cyclohexyl-4-oxopentyl) 1-O-methyl 2-methylbutanedioate is COC(=O)C(C)CC(=O)OCCCC(=O)CC1CCCCC1.
What is the InChIKey of 4-O-(5-cyclohexyl-4-oxopentyl) 1-O-methyl 2-methylbutanedioate?
The InChIKey is BLOMTDSWBABEIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O5/c1-13(17(20)21-2)11-16(19)22-10-6-9-15(18)12-14-7-4-3-5-8-14/h13-14H,3-12H2,1-2H3.
What are the key properties of 4-O-(5-cyclohexyl-4-oxopentyl) 1-O-methyl 2-methylbutanedioate?
4-O-(5-cyclohexyl-4-oxopentyl) 1-O-methyl 2-methylbutanedioate has a molecular weight of 312.41 g/mol, XLogP of 3.05, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(5-cyclohexyl-4-oxopentyl) 1-O-methyl 2-methylbutanedioate is sourced from PubChem (CID 123785670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).