About 3-N,3-N-dimethyl-1-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide
3-N,3-N-dimethyl-1-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide (PubChem CID 123785832) has the molecular formula C11H18N6
and a molecular weight of 234.31 g/mol. Its IUPAC name is 3-N,3-N-dimethyl-1-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide.
Molecular Properties
| Compound Name | 3-N,3-N-dimethyl-1-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide |
| PubChem CID | 123785832 |
| Molecular Formula | C11H18N6 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 3-N,3-N-dimethyl-1-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide |
| SMILES | [H]/N=C(/C/C(N)=N/c1cc(/C=C/C)[nH]n1)N(C)C |
| InChI | InChI=1S/C11H18N6/c1-4-5-8-6-11(16-15-8)14-9(12)7-10(13)17(2)3/h4-6,13H,7H2,1-3H3,(H3,12,14,15,16)/b5-4+,13-10- |
| InChIKey | IPVLSZANSGBEMJ-ODPUXILVSA-N |
| XLogP | 1.36 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-N,3-N-dimethyl-1-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,3-N-dimethyl-1-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide?
The IUPAC name of 3-N,3-N-dimethyl-1-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide (CID 123785832) is 3-N,3-N-dimethyl-1-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide.
What is the SMILES notation for 3-N,3-N-dimethyl-1-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide?
The canonical SMILES for 3-N,3-N-dimethyl-1-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide is [H]/N=C(/C/C(N)=N/c1cc(/C=C/C)[nH]n1)N(C)C.
What is the InChIKey of 3-N,3-N-dimethyl-1-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide?
The InChIKey is IPVLSZANSGBEMJ-ODPUXILVSA-N. The full InChI is InChI=1S/C11H18N6/c1-4-5-8-6-11(16-15-8)14-9(12)7-10(13)17(2)3/h4-6,13H,7H2,1-3H3,(H3,12,14,15,16)/b5-4+,13-10-.
What are the key properties of 3-N,3-N-dimethyl-1-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide?
3-N,3-N-dimethyl-1-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide has a molecular weight of 234.31 g/mol, XLogP of 1.36, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,3-N-dimethyl-1-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide is sourced from PubChem (CID 123785832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).