About 3-methyl-N-(4-phenylhepta-1,6-dien-4-yl)benzamide
3-methyl-N-(4-phenylhepta-1,6-dien-4-yl)benzamide (PubChem CID 1237860) has the molecular formula C21H23NO
and a molecular weight of 305.42 g/mol. Its IUPAC name is 3-methyl-N-(4-phenylhepta-1,6-dien-4-yl)benzamide.
Molecular Properties
| Compound Name | 3-methyl-N-(4-phenylhepta-1,6-dien-4-yl)benzamide |
| PubChem CID | 1237860 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 3-methyl-N-(4-phenylhepta-1,6-dien-4-yl)benzamide |
| SMILES | C=CCC(CC=C)(NC(=O)c1cccc(C)c1)c1ccccc1 |
| InChI | InChI=1S/C21H23NO/c1-4-14-21(15-5-2,19-12-7-6-8-13-19)22-20(23)18-11-9-10-17(3)16-18/h4-13,16H,1-2,14-15H2,3H3,(H,22,23) |
| InChIKey | SRBRTINPZCUJON-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-N-(4-phenylhepta-1,6-dien-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-(4-phenylhepta-1,6-dien-4-yl)benzamide?
The IUPAC name of 3-methyl-N-(4-phenylhepta-1,6-dien-4-yl)benzamide (CID 1237860) is 3-methyl-N-(4-phenylhepta-1,6-dien-4-yl)benzamide.
What is the SMILES notation for 3-methyl-N-(4-phenylhepta-1,6-dien-4-yl)benzamide?
The canonical SMILES for 3-methyl-N-(4-phenylhepta-1,6-dien-4-yl)benzamide is C=CCC(CC=C)(NC(=O)c1cccc(C)c1)c1ccccc1.
What is the InChIKey of 3-methyl-N-(4-phenylhepta-1,6-dien-4-yl)benzamide?
The InChIKey is SRBRTINPZCUJON-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO/c1-4-14-21(15-5-2,19-12-7-6-8-13-19)22-20(23)18-11-9-10-17(3)16-18/h4-13,16H,1-2,14-15H2,3H3,(H,22,23).
What are the key properties of 3-methyl-N-(4-phenylhepta-1,6-dien-4-yl)benzamide?
3-methyl-N-(4-phenylhepta-1,6-dien-4-yl)benzamide has a molecular weight of 305.42 g/mol, XLogP of 4.77, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-(4-phenylhepta-1,6-dien-4-yl)benzamide is sourced from PubChem (CID 1237860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).