C14H11NO2 — CID 123786016
2,12-dimethyl-1-azatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,11-pentaene-4,10-dione (PubChem CID 123786016) has the molecular formula C14H11NO2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2,12-dimethyl-1-azatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,11-pentaene-4,10-dione.
| Compound Name | 2,12-dimethyl-1-azatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,11-pentaene-4,10-dione |
|---|---|
| PubChem CID | 123786016 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 2,12-dimethyl-1-azatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,11-pentaene-4,10-dione |
| SMILES | Cc1cc(=O)c2cccc3c(=O)cc(C)n1c23 |
| InChI | InChI=1S/C14H11NO2/c1-8-6-12(16)10-4-3-5-11-13(17)7-9(2)15(8)14(10)11/h3-7H,1-2H3 |
| InChIKey | LSTVRJDONLJCBX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |