About 3-pentoxyoxiran-2-imine
3-pentoxyoxiran-2-imine (PubChem CID 123786139) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 3-pentoxyoxiran-2-imine.
Molecular Properties
| Compound Name | 3-pentoxyoxiran-2-imine |
| PubChem CID | 123786139 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 3-pentoxyoxiran-2-imine |
| SMILES | [H]/N=C1\OC1OCCCCC |
| InChI | InChI=1S/C7H13NO2/c1-2-3-4-5-9-7-6(8)10-7/h7-8H,2-5H2,1H3/b8-6- |
| InChIKey | PADBGLICHVBBQO-VURMDHGXSA-N |
| XLogP | 1.53 |
| TPSA | 45.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-pentoxyoxiran-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentoxyoxiran-2-imine?
The IUPAC name of 3-pentoxyoxiran-2-imine (CID 123786139) is 3-pentoxyoxiran-2-imine.
What is the SMILES notation for 3-pentoxyoxiran-2-imine?
The canonical SMILES for 3-pentoxyoxiran-2-imine is [H]/N=C1\OC1OCCCCC.
What is the InChIKey of 3-pentoxyoxiran-2-imine?
The InChIKey is PADBGLICHVBBQO-VURMDHGXSA-N. The full InChI is InChI=1S/C7H13NO2/c1-2-3-4-5-9-7-6(8)10-7/h7-8H,2-5H2,1H3/b8-6-.
What are the key properties of 3-pentoxyoxiran-2-imine?
3-pentoxyoxiran-2-imine has a molecular weight of 143.19 g/mol, XLogP of 1.53, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentoxyoxiran-2-imine is sourced from PubChem (CID 123786139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).