C25H36N2O2 — CID 123786211
1-(3-hydroxy-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-pyrazin-2-ylethanone (PubChem CID 123786211) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 1-(3-hydroxy-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-pyrazin-2-ylethanone.
| Compound Name | 1-(3-hydroxy-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-pyrazin-2-ylethanone |
|---|---|
| PubChem CID | 123786211 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 1-(3-hydroxy-3,13-dimethyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-pyrazin-2-ylethanone |
| SMILES | CC1(O)CCC2C(CCC3C2CCC2(C)C(C(=O)Cc4cnccn4)CCC32)C1 |
| InChI | InChI=1S/C25H36N2O2/c1-24(29)9-7-18-16(14-24)3-4-20-19(18)8-10-25(2)21(20)5-6-22(25)23(28)13-17-15-26-11-12-27-17/h11-12,15-16,18-22,29H,3-10,13-14H2,1-2H3 |
| InChIKey | XFEVDEMDKHZWKS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |