C21H30O4 — CID 123786466
4-ethenyl-20,20-dimethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-en-16-ol (PubChem CID 123786466) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 4-ethenyl-20,20-dimethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-en-16-ol.
| Compound Name | 4-ethenyl-20,20-dimethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-en-16-ol |
|---|---|
| PubChem CID | 123786466 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 4-ethenyl-20,20-dimethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-en-16-ol |
| SMILES | C=CC1OC2C3=CCCC(O)(CC4C5COC5CCC4C2O1)C3(C)C |
| InChI | InChI=1S/C21H30O4/c1-4-17-24-18-12-7-8-16-14(11-23-16)13(12)10-21(22)9-5-6-15(19(18)25-17)20(21,2)3/h4,6,12-14,16-19,22H,1,5,7-11H2,2-3H3 |
| InChIKey | AJRCPLVWOAUMTG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|