C25H33FO4Si — CID 123786575
tert-butyl-[[6-(fluoromethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy]-diphenylsilane (PubChem CID 123786575) has the molecular formula C25H33FO4Si and a molecular weight of 444.62 g/mol. Its IUPAC name is tert-butyl-[[6-(fluoromethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[6-(fluoromethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 123786575 |
| Molecular Formula | C25H33FO4Si |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | tert-butyl-[[6-(fluoromethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy]-diphenylsilane |
| SMILES | CC1(C)OC2OC(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C(CF)C2O1 |
| InChI | InChI=1S/C25H33FO4Si/c1-24(2,3)31(18-12-8-6-9-13-18,19-14-10-7-11-15-19)27-17-21-20(16-26)22-23(28-21)30-25(4,5)29-22/h6-15,20-23H,16-17H2,1-5H3 |
| InChIKey | ZMNKBYGZJKJBCW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|