C16H23N — CID 123786728
3,3-dimethyl-2-nona-3,5,7-trienyl-2H-pyridine (PubChem CID 123786728) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 3,3-dimethyl-2-nona-3,5,7-trienyl-2H-pyridine.
| Compound Name | 3,3-dimethyl-2-nona-3,5,7-trienyl-2H-pyridine |
|---|---|
| PubChem CID | 123786728 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 3,3-dimethyl-2-nona-3,5,7-trienyl-2H-pyridine |
| SMILES | CC=CC=CC=CCCC1N=CC=CC1(C)C |
| InChI | InChI=1S/C16H23N/c1-4-5-6-7-8-9-10-12-15-16(2,3)13-11-14-17-15/h4-9,11,13-15H,10,12H2,1-3H3 |
| InChIKey | HUIBJZHEICERCJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|