C21H33N6O9P — CID 123787554
8-amino-23,27,28-trihydroxy-21,28-dimethyl-23-oxo-11,19,24,29-tetraoxa-2,4,7,9,22-pentaza-23λ5-phosphatetracyclo[24.2.1.02,6.05,10]nonacosa-3,5,7,9-tetraen-20-one (PubChem CID 123787554) has the molecular formula C21H33N6O9P and a molecular weight of 544.50 g/mol. Its IUPAC name is 8-amino-23,27,28-trihydroxy-21,28-dimethyl-23-oxo-11,19,24,29-tetraoxa-2,4,7,9,22-pentaza-23λ5-phosphatetracyclo[24.2.1.02,6.05,10]nonacosa-3,5,7,9-tetraen-20-one.
| Compound Name | 8-amino-23,27,28-trihydroxy-21,28-dimethyl-23-oxo-11,19,24,29-tetraoxa-2,4,7,9,22-pentaza-23λ5-phosphatetracyclo[24.2.1.02,6.05,10]nonacosa-3,5,7,9-tetraen-20-one |
|---|---|
| PubChem CID | 123787554 |
| Molecular Formula | C21H33N6O9P |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | 8-amino-23,27,28-trihydroxy-21,28-dimethyl-23-oxo-11,19,24,29-tetraoxa-2,4,7,9,22-pentaza-23λ5-phosphatetracyclo[24.2.1.02,6.05,10]nonacosa-3,5,7,9-tetraen-20-one |
| SMILES | CC1NP(=O)(O)OCC2OC(n3cnc4c(nc(N)nc43)OCCCCCCCOC1=O)C(C)(O)C2O |
| InChI | InChI=1S/C21H33N6O9P/c1-12-18(29)34-9-7-5-3-4-6-8-33-17-14-16(24-20(22)25-17)27(11-23-14)19-21(2,30)15(28)13(36-19)10-35-37(31,32)26-12/h11-13,15,19,28,30H,3-10H2,1-2H3,(H2,22,24,25)(H2,26,31,32) |
| InChIKey | ROVKHPFUPAEIRX-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 213.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|