About 1-imino-7-methylocta-5,6-dien-2-one
1-imino-7-methylocta-5,6-dien-2-one (PubChem CID 123787671) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 1-imino-7-methylocta-5,6-dien-2-one.
Molecular Properties
| Compound Name | 1-imino-7-methylocta-5,6-dien-2-one |
| PubChem CID | 123787671 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 1-imino-7-methylocta-5,6-dien-2-one |
| SMILES | [H]/N=C/C(=O)CCC=C=C(C)C |
| InChI | InChI=1S/C9H13NO/c1-8(2)5-3-4-6-9(11)7-10/h3,7,10H,4,6H2,1-2H3/b10-7+ |
| InChIKey | GTOHUMIIBPIGFN-JXMROGBWSA-N |
| XLogP | 2.11 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-imino-7-methylocta-5,6-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-imino-7-methylocta-5,6-dien-2-one?
The IUPAC name of 1-imino-7-methylocta-5,6-dien-2-one (CID 123787671) is 1-imino-7-methylocta-5,6-dien-2-one.
What is the SMILES notation for 1-imino-7-methylocta-5,6-dien-2-one?
The canonical SMILES for 1-imino-7-methylocta-5,6-dien-2-one is [H]/N=C/C(=O)CCC=C=C(C)C.
What is the InChIKey of 1-imino-7-methylocta-5,6-dien-2-one?
The InChIKey is GTOHUMIIBPIGFN-JXMROGBWSA-N. The full InChI is InChI=1S/C9H13NO/c1-8(2)5-3-4-6-9(11)7-10/h3,7,10H,4,6H2,1-2H3/b10-7+.
What are the key properties of 1-imino-7-methylocta-5,6-dien-2-one?
1-imino-7-methylocta-5,6-dien-2-one has a molecular weight of 151.21 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-imino-7-methylocta-5,6-dien-2-one is sourced from PubChem (CID 123787671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).