About 3-[3-(3,3-diethylpentoxy)-3-methylpentoxy]-3-methyl-2-methylidenebutan-1-ol
3-[3-(3,3-diethylpentoxy)-3-methylpentoxy]-3-methyl-2-methylidenebutan-1-ol (PubChem CID 123788178) has the molecular formula C21H42O3
and a molecular weight of 342.56 g/mol. Its IUPAC name is 3-[3-(3,3-diethylpentoxy)-3-methylpentoxy]-3-methyl-2-methylidenebutan-1-ol.
Molecular Properties
| Compound Name | 3-[3-(3,3-diethylpentoxy)-3-methylpentoxy]-3-methyl-2-methylidenebutan-1-ol |
| PubChem CID | 123788178 |
| Molecular Formula | C21H42O3 |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.31 |
| IUPAC Name | 3-[3-(3,3-diethylpentoxy)-3-methylpentoxy]-3-methyl-2-methylidenebutan-1-ol |
| SMILES | C=C(CO)C(C)(C)OCCC(C)(CC)OCCC(CC)(CC)CC |
| InChI | InChI=1S/C21H42O3/c1-9-20(8,13-15-23-19(6,7)18(5)17-22)24-16-14-21(10-2,11-3)12-4/h22H,5,9-17H2,1-4,6-8H3 |
| InChIKey | DFSKSXOWRMNRMP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(3,3-diethylpentoxy)-3-methylpentoxy]-3-methyl-2-methylidenebutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(3,3-diethylpentoxy)-3-methylpentoxy]-3-methyl-2-methylidenebutan-1-ol?
The IUPAC name of 3-[3-(3,3-diethylpentoxy)-3-methylpentoxy]-3-methyl-2-methylidenebutan-1-ol (CID 123788178) is 3-[3-(3,3-diethylpentoxy)-3-methylpentoxy]-3-methyl-2-methylidenebutan-1-ol.
What is the SMILES notation for 3-[3-(3,3-diethylpentoxy)-3-methylpentoxy]-3-methyl-2-methylidenebutan-1-ol?
The canonical SMILES for 3-[3-(3,3-diethylpentoxy)-3-methylpentoxy]-3-methyl-2-methylidenebutan-1-ol is C=C(CO)C(C)(C)OCCC(C)(CC)OCCC(CC)(CC)CC.
What is the InChIKey of 3-[3-(3,3-diethylpentoxy)-3-methylpentoxy]-3-methyl-2-methylidenebutan-1-ol?
The InChIKey is DFSKSXOWRMNRMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42O3/c1-9-20(8,13-15-23-19(6,7)18(5)17-22)24-16-14-21(10-2,11-3)12-4/h22H,5,9-17H2,1-4,6-8H3.
What are the key properties of 3-[3-(3,3-diethylpentoxy)-3-methylpentoxy]-3-methyl-2-methylidenebutan-1-ol?
3-[3-(3,3-diethylpentoxy)-3-methylpentoxy]-3-methyl-2-methylidenebutan-1-ol has a molecular weight of 342.56 g/mol, XLogP of 5.51, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(3,3-diethylpentoxy)-3-methylpentoxy]-3-methyl-2-methylidenebutan-1-ol is sourced from PubChem (CID 123788178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).