C11H17F5N2O7S — CID 123788179
2-[[1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl]oxy]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid (PubChem CID 123788179) has the molecular formula C11H17F5N2O7S and a molecular weight of 416.32 g/mol. Its IUPAC name is 2-[[1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl]oxy]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid.
| Compound Name | 2-[[1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl]oxy]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 123788179 |
| Molecular Formula | C11H17F5N2O7S |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 2-[[1,3-bis(methoxymethyl)-2-oxo-1,3-diazinan-5-yl]oxy]-1,1,3,3,3-pentafluoropropane-1-sulfonic acid |
| SMILES | COCN1CC(OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)CN(COC)C1=O |
| InChI | InChI=1S/C11H17F5N2O7S/c1-23-5-17-3-7(4-18(6-24-2)9(17)19)25-8(10(12,13)14)11(15,16)26(20,21)22/h7-8H,3-6H2,1-2H3,(H,20,21,22) |
| InChIKey | RDVHRSPMMMCSAP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|